CAS 2055119-20-3 appears in our catalog under these names: 6-Bromo-2,4-difluoro-3-methylbenzoic acid, 6-Bromo-2,4-difluoro-3-methylbenzoic acid, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 5g, 10g, 1g.
6-bromo-2,4-difluoro-3-methylbenzoic acid (CAS 2055119-20-3) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: 6-bromo-2,4-difluoro-3-methylbenzoic acid. InChIKey: QZRAWLZCSMEUIE-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 6-bromo-2,4-difluoro-3-methylbenzoic acid |
| InChIKey | QZRAWLZCSMEUIE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1F)Br)C(=O)O)F |
Computed by PubChem (NCBI)