CAS 2089651-00-1 appears in our catalog under these names: 1-(4-FLUOROPHENYL)-2,2-DIFLUOROETHAN-1-AMINE HCL, 95%, 2,2-Difluoro-1-(4-fluorophenyl)ethan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,2-difluoro-1-(4-fluorophenyl)ethanamine;hydrochloride (CAS 2089651-00-1) is a chemical compound with the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. IUPAC name: 2,2-difluoro-1-(4-fluorophenyl)ethanamine;hydrochloride. InChIKey: FASWEAMMCPQTRD-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3N |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | 2,2-difluoro-1-(4-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | FASWEAMMCPQTRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)F)N)F.Cl |
Computed by PubChem (NCBI)