CAS 2092460-75-6 appears in our catalog under these names: 6-{((tert-butoxy)carbonyl)amino}-1H-indazole-3-carboxylic acid, 95%, 6-{((tert-Butoxy)carbonyl)amino}-1H-indazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-indazole-3-carboxylic acid (CAS 2092460-75-6) is a chemical compound with the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. IUPAC name: 6-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-indazole-3-carboxylic acid. InChIKey: IXYVGEBQOKOZJS-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O4 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | 6-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-indazole-3-carboxylic acid |
| InChIKey | IXYVGEBQOKOZJS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC2=C(C=C1)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)