Products 2098865-09-7
CAS 2098865-09-7 is the registry number for 4-Bromobenzo[kl]xanthene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
12-bromo-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene (CAS 2098865-09-7) is a chemical compound with the molecular formula C16H9BrO and a molecular weight of 297.14 g/mol. IUPAC name: 12-bromo-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene. InChIKey: ZFVVBVGMJUZEDG-UHFFFAOYSA-N.
| Molecular formula | C16H9BrO |
|---|---|
| Molecular weight | 297.14 g/mol |
| IUPAC name | 12-bromo-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene |
| InChIKey | ZFVVBVGMJUZEDG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC4=C(C=CC(=C43)O2)Br |
Computed by PubChem (NCBI)