CAS 1256544-32-7 appears in our catalog under these names: 3–Bromonaphtho(2,3–b)benzofuran, 3-Bromonaphtho[2,3-B]Benzofuran, 98%, 98%, 3-Bromonaphtho[2,3-b]benzofuran, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 25g.
3-bromonaphtho[2,3-b][1]benzofuran (CAS 1256544-32-7) is a chemical compound with the molecular formula C16H9BrO and a molecular weight of 297.14 g/mol. IUPAC name: 3-bromonaphtho[2,3-b][1]benzofuran. InChIKey: BBLXKCGFKPLRQK-UHFFFAOYSA-N.
| Molecular formula | C16H9BrO |
|---|---|
| Molecular weight | 297.14 g/mol |
| IUPAC name | 3-bromonaphtho[2,3-b][1]benzofuran |
| InChIKey | BBLXKCGFKPLRQK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C4=C(O3)C=C(C=C4)Br |
Computed by PubChem (NCBI)