CAS 1627917-16-1 appears in our catalog under these names: 2–Bromobenzo(b)naphtho(2,3–d)furan, 2-Bromobenzo[b]naphtho[2,3-d]furan, >98.0%(GC), 2-Bromobenzo[b]naphtho[2,3-d]furan, 97%, 97%, 2-Bromonaphtho[2,3-b]benzofuran, 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
2-bromonaphtho[2,3-b][1]benzofuran (CAS 1627917-16-1) is a chemical compound with the molecular formula C16H9BrO and a molecular weight of 297.14 g/mol. IUPAC name: 2-bromonaphtho[2,3-b][1]benzofuran. InChIKey: SXNOGSKQBHIZHE-UHFFFAOYSA-N.
| Molecular formula | C16H9BrO |
|---|---|
| Molecular weight | 297.14 g/mol |
| IUPAC name | 2-bromonaphtho[2,3-b][1]benzofuran |
| InChIKey | SXNOGSKQBHIZHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C4=C(O3)C=CC(=C4)Br |
Computed by PubChem (NCBI)