Products 1256544-17-8

CAS 1256544-17-8 is the registry number for 5-Bromonaphtho[1,2-b]benzofuran, 99%(GC-MS),RG, 99%(GC-MS),RG. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

5-bromonaphtho[1,2-b][1]benzofuran (CAS 1256544-17-8) is a chemical compound with the molecular formula C16H9BrO and a molecular weight of 297.14 g/mol. IUPAC name: 5-bromonaphtho[1,2-b][1]benzofuran. InChIKey: YTFLJMRDSPVJIX-UHFFFAOYSA-N.

Identity
Molecular formulaC16H9BrO
Molecular weight297.14 g/mol
IUPAC name5-bromonaphtho[1,2-b][1]benzofuran
InChIKeyYTFLJMRDSPVJIX-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=CC3=C2OC4=CC=CC=C43)Br

Computed by PubChem (NCBI)