CAS 2172929-14-3 appears in our catalog under these names: 7-Bromonaphtho[1,2-b]benzofuran, >98.0%(GC), 7-Bromonaphtho[1,2-b]benzofuran, 98%, 98%, 7-Bromonaphtho[1,2-b]benzofuran, 98%. Offered by: TCI, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 25g.
7-bromonaphtho[1,2-b][1]benzofuran (CAS 2172929-14-3) is a chemical compound with the molecular formula C16H9BrO and a molecular weight of 297.14 g/mol. IUPAC name: 7-bromonaphtho[1,2-b][1]benzofuran. InChIKey: FAHHZSWXOUVTNP-UHFFFAOYSA-N.
| Molecular formula | C16H9BrO |
|---|---|
| Molecular weight | 297.14 g/mol |
| IUPAC name | 7-bromonaphtho[1,2-b][1]benzofuran |
| InChIKey | FAHHZSWXOUVTNP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2OC4=C3C(=CC=C4)Br |
Computed by PubChem (NCBI)