Products 1256544-27-0

CAS 1256544-27-0 is the registry number for 9-Bromonaphtho[2,1-b]benzofuran, 99%, 99%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

9-bromonaphtho[2,1-b][1]benzofuran (CAS 1256544-27-0) is a chemical compound with the molecular formula C16H9BrO and a molecular weight of 297.14 g/mol. IUPAC name: 9-bromonaphtho[2,1-b][1]benzofuran. InChIKey: YFDUWPBKHIYLBJ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H9BrO
Molecular weight297.14 g/mol
IUPAC name9-bromonaphtho[2,1-b][1]benzofuran
InChIKeyYFDUWPBKHIYLBJ-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC3=C2C4=C(O3)C=C(C=C4)Br

Computed by PubChem (NCBI)