CAS 1256544-27-0 is the registry number for 9-Bromonaphtho[2,1-b]benzofuran, 99%, 99%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g.
9-bromonaphtho[2,1-b][1]benzofuran (CAS 1256544-27-0) is a chemical compound with the molecular formula C16H9BrO and a molecular weight of 297.14 g/mol. IUPAC name: 9-bromonaphtho[2,1-b][1]benzofuran. InChIKey: YFDUWPBKHIYLBJ-UHFFFAOYSA-N.
| Molecular formula | C16H9BrO |
|---|---|
| Molecular weight | 297.14 g/mol |
| IUPAC name | 9-bromonaphtho[2,1-b][1]benzofuran |
| InChIKey | YFDUWPBKHIYLBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C4=C(O3)C=C(C=C4)Br |
Computed by PubChem (NCBI)