Products 2189692-40-6

CAS 2189692-40-6 is the registry number for 1-Bromonaphtho[2,3-b]benzofuran, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

1-bromonaphtho[2,3-b][1]benzofuran (CAS 2189692-40-6) is a chemical compound with the molecular formula C16H9BrO and a molecular weight of 297.14 g/mol. IUPAC name: 1-bromonaphtho[2,3-b][1]benzofuran. InChIKey: OXNHYMLBKZHTGC-UHFFFAOYSA-N.

Identity
Molecular formulaC16H9BrO
Molecular weight297.14 g/mol
IUPAC name1-bromonaphtho[2,3-b][1]benzofuran
InChIKeyOXNHYMLBKZHTGC-UHFFFAOYSA-N
SMILESC1=CC=C2C=C3C(=CC2=C1)C4=C(O3)C=CC=C4Br

Computed by PubChem (NCBI)