CAS 114562-65-1 appears in our catalog under these names: 6-Bromo-1-hydroxypyrene, 6-Bromopyren-1-ol, 95%. Offered by: TRC, Biosynth, Ambeed. Available pack sizes: 100mg, 50mg, 25mg, 250mg, 1g.
6-bromopyren-1-ol (CAS 114562-65-1) is a chemical compound with the molecular formula C16H9BrO and a molecular weight of 297.14 g/mol. IUPAC name: 6-bromopyren-1-ol. InChIKey: XFLCKLCWZVOBOX-UHFFFAOYSA-N.
| Molecular formula | C16H9BrO |
|---|---|
| Molecular weight | 297.14 g/mol |
| IUPAC name | 6-bromopyren-1-ol |
| InChIKey | XFLCKLCWZVOBOX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C4=C1C=CC(=C4C=C3)Br)O |
Computed by PubChem (NCBI)