CAS 1256544-20-3 appears in our catalog under these names: 10–Bromobenzo(b)naphtho(1,2–d)furan, 10-Bromobenzo[b]Naphtho[1,2-d]Furan, 98%, 98%, 10-bromobenzo[b]naphtho[1,2-d]furan, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g.
10-bromonaphtho[2,1-b][1]benzofuran (CAS 1256544-20-3) is a chemical compound with the molecular formula C16H9BrO and a molecular weight of 297.14 g/mol. IUPAC name: 10-bromonaphtho[2,1-b][1]benzofuran. InChIKey: XUBMUSJSZQBFJK-UHFFFAOYSA-N.
| Molecular formula | C16H9BrO |
|---|---|
| Molecular weight | 297.14 g/mol |
| IUPAC name | 10-bromonaphtho[2,1-b][1]benzofuran |
| InChIKey | XUBMUSJSZQBFJK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C4=C(O3)C=CC(=C4)Br |
Computed by PubChem (NCBI)