CAS 1642127-11-4 is the registry number for 4-Bromobenzo[b]naphtho[2,3-d]furan, 99%, 99%. Offered by: Chemat. Available pack sizes: 25g, 100g.
4-bromonaphtho[2,3-b][1]benzofuran (CAS 1642127-11-4) is a chemical compound with the molecular formula C16H9BrO and a molecular weight of 297.14 g/mol. IUPAC name: 4-bromonaphtho[2,3-b][1]benzofuran. InChIKey: SREAXXNZVNXROI-UHFFFAOYSA-N.
| Molecular formula | C16H9BrO |
|---|---|
| Molecular weight | 297.14 g/mol |
| IUPAC name | 4-bromonaphtho[2,3-b][1]benzofuran |
| InChIKey | SREAXXNZVNXROI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C4=C(O3)C(=CC=C4)Br |
Computed by PubChem (NCBI)