Products 1622452-00-9

CAS 1622452-00-9 is the registry number for 5-Bromobenzo[b]naphtho[1,2-d]furan, 99%, 99%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 15g, 25g.

Structural formula: {0} (CAS {1})

5-bromonaphtho[2,1-b][1]benzofuran (CAS 1622452-00-9) is a chemical compound with the molecular formula C16H9BrO and a molecular weight of 297.14 g/mol. IUPAC name: 5-bromonaphtho[2,1-b][1]benzofuran. InChIKey: BCHKGTACONSUPC-UHFFFAOYSA-N.

Identity
Molecular formulaC16H9BrO
Molecular weight297.14 g/mol
IUPAC name5-bromonaphtho[2,1-b][1]benzofuran
InChIKeyBCHKGTACONSUPC-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=CC3=C2C4=CC=CC=C4O3)Br

Computed by PubChem (NCBI)