CAS 1622452-00-9 is the registry number for 5-Bromobenzo[b]naphtho[1,2-d]furan, 99%, 99%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 15g, 25g.
5-bromonaphtho[2,1-b][1]benzofuran (CAS 1622452-00-9) is a chemical compound with the molecular formula C16H9BrO and a molecular weight of 297.14 g/mol. IUPAC name: 5-bromonaphtho[2,1-b][1]benzofuran. InChIKey: BCHKGTACONSUPC-UHFFFAOYSA-N.
| Molecular formula | C16H9BrO |
|---|---|
| Molecular weight | 297.14 g/mol |
| IUPAC name | 5-bromonaphtho[2,1-b][1]benzofuran |
| InChIKey | BCHKGTACONSUPC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC3=C2C4=CC=CC=C4O3)Br |
Computed by PubChem (NCBI)