Products 2167386-60-7
CAS 2167386-60-7 appears in our catalog under these names: 4-Bromo-3-(difluoromethyl)benzoic acid, 95%, 95%, 4-Bromo-3-(difluoromethyl)benzoic acid 95%, 4-Bromo-3-(difluoromethyl)benzoic acid, 95%, 4-Bromo-3-(difluoromethyl)benzoic acid, 98%. Offered by: Chemat, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g, 25g.
4-bromo-3-(difluoromethyl)benzoic acid (CAS 2167386-60-7) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: 4-bromo-3-(difluoromethyl)benzoic acid. InChIKey: BHKUQEMAVZWRMC-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 4-bromo-3-(difluoromethyl)benzoic acid |
| InChIKey | BHKUQEMAVZWRMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(F)F)Br |
Computed by PubChem (NCBI)