CAS 2170848-14-1 is the registry number for 2-(1H-1,2,4-Triazol-1-yl)terephthalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1,2,4-triazol-1-yl)terephthalic acid (CAS 2170848-14-1) is a chemical compound with the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. IUPAC name: 2-(1,2,4-triazol-1-yl)terephthalic acid. InChIKey: HISPXWSTPJFDDI-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O4 |
|---|---|
| Molecular weight | 233.18 g/mol |
| IUPAC name | 2-(1,2,4-triazol-1-yl)terephthalic acid |
| InChIKey | HISPXWSTPJFDDI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)N2C=NC=N2)C(=O)O |
Computed by PubChem (NCBI)