Products 2172240-86-5
CAS 2172240-86-5 is the registry number for 1-(2,2-Difluorocyclopropyl)-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(2,2-difluorocyclopropyl)pyrazole-4-carboxylic acid (CAS 2172240-86-5) is a chemical compound with the molecular formula C7H6F2N2O2 and a molecular weight of 188.13 g/mol. IUPAC name: 1-(2,2-difluorocyclopropyl)pyrazole-4-carboxylic acid. InChIKey: XOSUOSQZVIFQJM-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O2 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 1-(2,2-difluorocyclopropyl)pyrazole-4-carboxylic acid |
| InChIKey | XOSUOSQZVIFQJM-UHFFFAOYSA-N |
| SMILES | C1C(C1(F)F)N2C=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)