Products 2225143-99-5
CAS 2225143-99-5 is the registry number for (1,2-Dihydroacenaphthylen-5-yl)hydrazine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,2-dihydroacenaphthylen-5-ylhydrazine;hydrochloride (CAS 2225143-99-5) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: 1,2-dihydroacenaphthylen-5-ylhydrazine;hydrochloride. InChIKey: JWMVKNXGZYTTPY-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | 1,2-dihydroacenaphthylen-5-ylhydrazine;hydrochloride |
| InChIKey | JWMVKNXGZYTTPY-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=C(C3=CC=CC1=C23)NN.Cl |
Computed by PubChem (NCBI)