CAS 2241598-39-8 appears in our catalog under these names: 5–(1H–1,2,4–Triazol–1–yl)isophthalic acid, 5-(1H-1,2,4-Triazol-1-yl)isophthalic acid, 95%, 95%, 5-(1H-1,2,4-Triazol-1-yl)isophthalic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
5-(1,2,4-triazol-1-yl)benzene-1,3-dicarboxylic acid (CAS 2241598-39-8) is a chemical compound with the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. IUPAC name: 5-(1,2,4-triazol-1-yl)benzene-1,3-dicarboxylic acid. InChIKey: QBSPMFYSIXEACD-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O4 |
|---|---|
| Molecular weight | 233.18 g/mol |
| IUPAC name | 5-(1,2,4-triazol-1-yl)benzene-1,3-dicarboxylic acid |
| InChIKey | QBSPMFYSIXEACD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)N2C=NC=N2)C(=O)O |
Computed by PubChem (NCBI)