Products 2359690-91-6
CAS 2359690-91-6 is the registry number for 4,6-dichloro-5-(1,3-dioxolan-2-yl)-2-methyl-pyrimidine, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
4,6-dichloro-5-(1,3-dioxolan-2-yl)-2-methylpyrimidine (CAS 2359690-91-6) is a chemical compound with the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.06 g/mol. IUPAC name: 4,6-dichloro-5-(1,3-dioxolan-2-yl)-2-methylpyrimidine. InChIKey: KWHOJGMFJHLVNN-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O2 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 4,6-dichloro-5-(1,3-dioxolan-2-yl)-2-methylpyrimidine |
| InChIKey | KWHOJGMFJHLVNN-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(C(=N1)Cl)C2OCCO2)Cl |
Computed by PubChem (NCBI)