CAS 24011-15-2 is the registry number for 3-(3-Nitrophenyl)-4,5-dihydro-1,2,4-oxadiazol-5-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(3-nitrophenyl)-4H-1,2,4-oxadiazol-5-one (CAS 24011-15-2) is a chemical compound with the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. IUPAC name: 3-(3-nitrophenyl)-4H-1,2,4-oxadiazol-5-one. InChIKey: COXDLQHDPALXMA-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O4 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 3-(3-nitrophenyl)-4H-1,2,4-oxadiazol-5-one |
| InChIKey | COXDLQHDPALXMA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=NOC(=O)N2 |
Computed by PubChem (NCBI)