Products 2514952-69-1
CAS 2514952-69-1 appears in our catalog under these names: Nintedanib Impurity 1 (Intedanib Impurity 1), dimethyl 2-oxoindoline-3,6-dicarboxylate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg, 750mg.
Dimethyl 2-oxo-1,3-dihydroindole-3,6-dicarboxylate (CAS 2514952-69-1) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: dimethyl 2-oxo-1,3-dihydroindole-3,6-dicarboxylate. InChIKey: MVPPQNDAPAHWMX-UHFFFAOYSA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | dimethyl 2-oxo-1,3-dihydroindole-3,6-dicarboxylate |
| InChIKey | MVPPQNDAPAHWMX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1C2=C(C=C(C=C2)C(=O)OC)NC1=O |
Computed by PubChem (NCBI)