CAS 2530-99-6 is the registry number for Theophylline Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.
3,7-dimethyl-1-prop-2-enylpurine-2,6-dione (CAS 2530-99-6) is a chemical compound with the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. IUPAC name: 3,7-dimethyl-1-prop-2-enylpurine-2,6-dione. InChIKey: BTFHIKZOEZREBX-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2 |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | 3,7-dimethyl-1-prop-2-enylpurine-2,6-dione |
| InChIKey | BTFHIKZOEZREBX-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1C(=O)N(C(=O)N2C)CC=C |
Computed by PubChem (NCBI)