CAS 2639415-31-7 is the registry number for 2,2-Difluoro-2-(2-fluorophenyl)ethan-1-amine hydrochloride, 96%. Offered by: AmBeed. Available pack sizes: 250mg, 100mg, 1g.
2,2-difluoro-2-(2-fluorophenyl)ethanamine;hydrochloride (CAS 2639415-31-7) is a chemical compound with the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. IUPAC name: 2,2-difluoro-2-(2-fluorophenyl)ethanamine;hydrochloride. InChIKey: CWAFGAUTOHCAHP-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3N |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | 2,2-difluoro-2-(2-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | CWAFGAUTOHCAHP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(CN)(F)F)F.Cl |
Computed by PubChem (NCBI)