CAS 2673369-26-9 is the registry number for 2-Chloro-7,7-dimethylfuro[3,4-b]pyridin-5(7H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-7,7-dimethylfuro[3,4-b]pyridin-5-one (CAS 2673369-26-9) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: 2-chloro-7,7-dimethylfuro[3,4-b]pyridin-5-one. InChIKey: RTADFLWVDRADMN-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 2-chloro-7,7-dimethylfuro[3,4-b]pyridin-5-one |
| InChIKey | RTADFLWVDRADMN-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=N2)Cl)C(=O)O1)C |
Computed by PubChem (NCBI)