Products 2713992-91-5
CAS 2713992-91-5 is the registry number for 1-Chloro-6,7-dihydro-5H-cyclopenta(c)pyridine-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 10g, 5g, 25g.
1-chloro-6,7-dihydro-5H-cyclopenta[c]pyridine-6-carboxylic acid (CAS 2713992-91-5) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: 1-chloro-6,7-dihydro-5H-cyclopenta[c]pyridine-6-carboxylic acid. InChIKey: OGCXBPSEXBJMGL-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 1-chloro-6,7-dihydro-5H-cyclopenta[c]pyridine-6-carboxylic acid |
| InChIKey | OGCXBPSEXBJMGL-UHFFFAOYSA-N |
| SMILES | C1C(CC2=C1C=CN=C2Cl)C(=O)O |
Computed by PubChem (NCBI)