Products 279231-42-4
CAS 279231-42-4 is the registry number for 4,5-Difluoro-N-methyl-2-nitroaniline, 95+%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
4,5-difluoro-N-methyl-2-nitroaniline (CAS 279231-42-4) is a chemical compound with the molecular formula C7H6F2N2O2 and a molecular weight of 188.13 g/mol. IUPAC name: 4,5-difluoro-N-methyl-2-nitroaniline. InChIKey: UXPQSEUSGVVMTK-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O2 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 4,5-difluoro-N-methyl-2-nitroaniline |
| InChIKey | UXPQSEUSGVVMTK-UHFFFAOYSA-N |
| SMILES | CNC1=CC(=C(C=C1[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)