Products 2940961-69-1
CAS 2940961-69-1 is the registry number for methyl 3-ethylazetidine-3-carboxylate,2,2,2-trifluoroacetic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl 3-ethylazetidine-3-carboxylate;2,2,2-trifluoroacetic acid (CAS 2940961-69-1) is a chemical compound with the molecular formula C9H14F3NO4 and a molecular weight of 257.21 g/mol. IUPAC name: methyl 3-ethylazetidine-3-carboxylate;2,2,2-trifluoroacetic acid. InChIKey: IPUYWCARVBHVCN-UHFFFAOYSA-N.
| Molecular formula | C9H14F3NO4 |
|---|---|
| Molecular weight | 257.21 g/mol |
| IUPAC name | methyl 3-ethylazetidine-3-carboxylate;2,2,2-trifluoroacetic acid |
| InChIKey | IPUYWCARVBHVCN-UHFFFAOYSA-N |
| SMILES | CCC1(CNC1)C(=O)OC.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)