Products 332-30-9

CAS 332-30-9 is the registry number for 2-Amino-3-(4-fluorophenyl)propanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-amino-3-(4-fluorophenyl)propanoic acid;hydrochloride (CAS 332-30-9) is a chemical compound with the molecular formula C9H11ClFNO2 and a molecular weight of 219.64 g/mol. IUPAC name: 2-amino-3-(4-fluorophenyl)propanoic acid;hydrochloride. InChIKey: ZDECBCKSULAIGP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClFNO2
Molecular weight219.64 g/mol
IUPAC name2-amino-3-(4-fluorophenyl)propanoic acid;hydrochloride
InChIKeyZDECBCKSULAIGP-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CC(C(=O)O)N)F.Cl

Computed by PubChem (NCBI)