CAS 122839-52-5 appears in our catalog under these names: 4-Fluoro-D-phenylalanine HCl/ 99.5% (existing batch purity), H–D–Phe(4–F)–OH ?HCl, 4-FLUORO-D-PHENYLALANINE HYDROCHLORIDE,&, 4-Fluoro-D-phenylalanine hydrochloride, 98%. Offered by: TargetMol, GLPBio, Sigma-Aldrich, Fluorochem. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 25g, 5g.
(2R)-2-amino-3-(4-fluorophenyl)propanoic acid;hydrochloride (CAS 122839-52-5) is a chemical compound with the molecular formula C9H11ClFNO2 and a molecular weight of 219.64 g/mol. IUPAC name: (2R)-2-amino-3-(4-fluorophenyl)propanoic acid;hydrochloride. InChIKey: ZDECBCKSULAIGP-DDWIOCJRSA-N.
| Molecular formula | C9H11ClFNO2 |
|---|---|
| Molecular weight | 219.64 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-fluorophenyl)propanoic acid;hydrochloride |
| InChIKey | ZDECBCKSULAIGP-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](C(=O)O)N)F.Cl |
Computed by PubChem (NCBI)