CAS 1391358-28-3 appears in our catalog under these names: (S)-4-(1-Aminoethyl)-2-fluorobenzoic acid hydrochloride, 97%, (S)–4–(1–Aminoethyl)–2–fluorobenzoic acid hydrochloride. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
4-[(1S)-1-aminoethyl]-2-fluorobenzoic acid;hydrochloride (CAS 1391358-28-3) is a chemical compound with the molecular formula C9H11ClFNO2 and a molecular weight of 219.64 g/mol. IUPAC name: 4-[(1S)-1-aminoethyl]-2-fluorobenzoic acid;hydrochloride. InChIKey: XONSGAXDQPRIKP-JEDNCBNOSA-N.
| Molecular formula | C9H11ClFNO2 |
|---|---|
| Molecular weight | 219.64 g/mol |
| IUPAC name | 4-[(1S)-1-aminoethyl]-2-fluorobenzoic acid;hydrochloride |
| InChIKey | XONSGAXDQPRIKP-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=CC(=C(C=C1)C(=O)O)F)N.Cl |
Computed by PubChem (NCBI)