Products 439213-22-6
CAS 439213-22-6 appears in our catalog under these names: Methyl d-2-(4-fluorophenyl)glycinate hydrochloride, 98%, (R)-Methyl 2-amino-2-(4-fluorophenyl)acetate hydrochloride, 97%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 25g, 5g, 1g, on request.
Methyl (2R)-2-amino-2-(4-fluorophenyl)acetate;hydrochloride (CAS 439213-22-6) is a chemical compound with the molecular formula C9H11ClFNO2 and a molecular weight of 219.64 g/mol. IUPAC name: methyl (2R)-2-amino-2-(4-fluorophenyl)acetate;hydrochloride. InChIKey: JLGSKYIBZLQSFR-DDWIOCJRSA-N.
| Molecular formula | C9H11ClFNO2 |
|---|---|
| Molecular weight | 219.64 g/mol |
| IUPAC name | methyl (2R)-2-amino-2-(4-fluorophenyl)acetate;hydrochloride |
| InChIKey | JLGSKYIBZLQSFR-DDWIOCJRSA-N |
| SMILES | COC(=O)[C@@H](C1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
Methyl D-2-(4-fluorophenyl)glycinate HCl, (R)-Methyl 2-amino-2-(4-fluorophenyl)acetate hydrochloride, Methyl D-2-(4-fluorophenyl)glycinate hydrochloride, methyl (2R)-2-amino-2-(4-fluorophenyl)acetate;hydrochloride, Methyl (R)-2-amino-2-(4-fluorophenyl)acetate hydrochloride, Methyl (2R)-amino(4-fluorophenyl)acetate--hydrogen chloride (1/1)