CAS 122839-51-4 appears in our catalog under these names: 2-Fluoro-d-phenylalanine, 95%, H-D-Phe(2-F)-OH.HCl, 98%, H–D–Phe(2–F)–OH·HCl, H-D-Phe(2-F)-OH*HCl. Offered by: Combi-blocks, AmBeed, GLPBio, Iris Biotech. Available pack sizes: 1g, 10g, 25g, 5g, 250mg.
(2R)-2-amino-3-(2-fluorophenyl)propanoic acid;hydrochloride (CAS 122839-51-4) is a chemical compound with the molecular formula C9H11ClFNO2 and a molecular weight of 219.64 g/mol. IUPAC name: (2R)-2-amino-3-(2-fluorophenyl)propanoic acid;hydrochloride. InChIKey: YSTOPARNEYKWBQ-DDWIOCJRSA-N.
| Molecular formula | C9H11ClFNO2 |
|---|---|
| Molecular weight | 219.64 g/mol |
| IUPAC name | (2R)-2-amino-3-(2-fluorophenyl)propanoic acid;hydrochloride |
| InChIKey | YSTOPARNEYKWBQ-DDWIOCJRSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@H](C(=O)O)N)F.Cl |
Computed by PubChem (NCBI)