CAS 1820686-43-8 is the registry number for Methyl 2-(4-amino-2-fluorophenyl)acetate hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
Methyl 2-(4-amino-2-fluorophenyl)acetate;hydrochloride (CAS 1820686-43-8) is a chemical compound with the molecular formula C9H11ClFNO2 and a molecular weight of 219.64 g/mol. IUPAC name: methyl 2-(4-amino-2-fluorophenyl)acetate;hydrochloride. InChIKey: OJWLOJYVXQZUHU-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFNO2 |
|---|---|
| Molecular weight | 219.64 g/mol |
| IUPAC name | methyl 2-(4-amino-2-fluorophenyl)acetate;hydrochloride |
| InChIKey | OJWLOJYVXQZUHU-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C=C(C=C1)N)F.Cl |
Computed by PubChem (NCBI)