Products 1820686-43-8

CAS 1820686-43-8 is the registry number for Methyl 2-(4-amino-2-fluorophenyl)acetate hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-(4-amino-2-fluorophenyl)acetate;hydrochloride (CAS 1820686-43-8) is a chemical compound with the molecular formula C9H11ClFNO2 and a molecular weight of 219.64 g/mol. IUPAC name: methyl 2-(4-amino-2-fluorophenyl)acetate;hydrochloride. InChIKey: OJWLOJYVXQZUHU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClFNO2
Molecular weight219.64 g/mol
IUPAC namemethyl 2-(4-amino-2-fluorophenyl)acetate;hydrochloride
InChIKeyOJWLOJYVXQZUHU-UHFFFAOYSA-N
SMILESCOC(=O)CC1=C(C=C(C=C1)N)F.Cl

Computed by PubChem (NCBI)