Products 7655-55-2

CAS 7655-55-2 is the registry number for 2-Amino-3-(3-fluorophenyl)propanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

2-amino-3-(3-fluorophenyl)propanoic acid;hydrochloride (CAS 7655-55-2) is a chemical compound with the molecular formula C9H11ClFNO2 and a molecular weight of 219.64 g/mol. IUPAC name: 2-amino-3-(3-fluorophenyl)propanoic acid;hydrochloride. InChIKey: HXXPJRIARBMPKG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClFNO2
Molecular weight219.64 g/mol
IUPAC name2-amino-3-(3-fluorophenyl)propanoic acid;hydrochloride
InChIKeyHXXPJRIARBMPKG-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)F)CC(C(=O)O)N.Cl

Computed by PubChem (NCBI)