Products 193633-57-7
CAS 193633-57-7 appears in our catalog under these names: 3-Amino-3-(3-fluorophenyl)propanoic acid hydrochloride, 95%, 3-Amino-3-(3-fluorophenyl)propanoic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g, 0,25g.
3-amino-3-(3-fluorophenyl)propanoic acid;hydrochloride (CAS 193633-57-7) is a chemical compound with the molecular formula C9H11ClFNO2 and a molecular weight of 219.64 g/mol. IUPAC name: 3-amino-3-(3-fluorophenyl)propanoic acid;hydrochloride. InChIKey: OLDBXSVVQBASPG-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFNO2 |
|---|---|
| Molecular weight | 219.64 g/mol |
| IUPAC name | 3-amino-3-(3-fluorophenyl)propanoic acid;hydrochloride |
| InChIKey | OLDBXSVVQBASPG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(CC(=O)O)N.Cl |
Computed by PubChem (NCBI)