CAS 916602-09-0 appears in our catalog under these names: Methyl L-2-(4-fluorophenyl)glycinate hydrochloride, 98%, (S)–Methyl 2–amino–2–(4–fluorophenyl)acetate hydrochloride, (S)-Methyl 2-amino-2-(4-fluorophenyl)acetate hydrochloride 98%, Methyl L-2-(4-fluorophenyl)glycinate HCl, 97%, 97%, METHYL L-2-(4-FLUOROPHENYL)GLYCINATE HYDROCHLORIDE, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 10g, 25g, 5g, 1g, 250mg, 100mg.
Methyl (2S)-2-amino-2-(4-fluorophenyl)acetate;hydrochloride (CAS 916602-09-0) is a chemical compound with the molecular formula C9H11ClFNO2 and a molecular weight of 219.64 g/mol. IUPAC name: methyl (2S)-2-amino-2-(4-fluorophenyl)acetate;hydrochloride. InChIKey: JLGSKYIBZLQSFR-QRPNPIFTSA-N.
| Molecular formula | C9H11ClFNO2 |
|---|---|
| Molecular weight | 219.64 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-(4-fluorophenyl)acetate;hydrochloride |
| InChIKey | JLGSKYIBZLQSFR-QRPNPIFTSA-N |
| SMILES | COC(=O)[C@H](C1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)