Products 490034-80-5
CAS 490034-80-5 appears in our catalog under these names: (S)-3-Amino-3-(3-fluorophenyl)propanoic acid hydrochloride, 95%, (S)-3-Amino-3-(3-fluorophenyl)propanoic acid hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g, 5g.
(3S)-3-amino-3-(3-fluorophenyl)propanoic acid;hydrochloride (CAS 490034-80-5) is a chemical compound with the molecular formula C9H11ClFNO2 and a molecular weight of 219.64 g/mol. IUPAC name: (3S)-3-amino-3-(3-fluorophenyl)propanoic acid;hydrochloride. InChIKey: OLDBXSVVQBASPG-QRPNPIFTSA-N.
| Molecular formula | C9H11ClFNO2 |
|---|---|
| Molecular weight | 219.64 g/mol |
| IUPAC name | (3S)-3-amino-3-(3-fluorophenyl)propanoic acid;hydrochloride |
| InChIKey | OLDBXSVVQBASPG-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC(=C1)F)[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)