CAS 35251-99-1 appears in our catalog under these names: 2,3–Dichloropyrido(3,4–b)pyrazine, 2,3-dichloropyrido(3,4-b)pyrazine, 2,3-Dichloropyrido[3,4-b]pyrazine 95%, 2,3-Dichloropyrido[3,4-b]pyrazine, 95%, 95%, 2,3-DICHLOROPYRIDO[3,4-B]PYRAZINE, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 5g.
2,3-dichloropyrido[3,4-b]pyrazine (CAS 35251-99-1) is a chemical compound with the molecular formula C7H3Cl2N3 and a molecular weight of 200.02 g/mol. IUPAC name: 2,3-dichloropyrido[3,4-b]pyrazine. InChIKey: GZTHKSLJDQQAGP-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3 |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 2,3-dichloropyrido[3,4-b]pyrazine |
| InChIKey | GZTHKSLJDQQAGP-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)