CAS 3600-77-9 is the registry number for 5-Azidoisophthalic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-azidobenzene-1,3-dicarboxylic acid (CAS 3600-77-9) is a chemical compound with the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. IUPAC name: 5-azidobenzene-1,3-dicarboxylic acid. InChIKey: VBYIQUXRWBDNSS-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O4 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 5-azidobenzene-1,3-dicarboxylic acid |
| InChIKey | VBYIQUXRWBDNSS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)N=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)