Products 3600-77-9

CAS 3600-77-9 is the registry number for 5-Azidoisophthalic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-azidobenzene-1,3-dicarboxylic acid (CAS 3600-77-9) is a chemical compound with the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. IUPAC name: 5-azidobenzene-1,3-dicarboxylic acid. InChIKey: VBYIQUXRWBDNSS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5N3O4
Molecular weight207.14 g/mol
IUPAC name5-azidobenzene-1,3-dicarboxylic acid
InChIKeyVBYIQUXRWBDNSS-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1C(=O)O)N=[N+]=[N-])C(=O)O

Computed by PubChem (NCBI)