Products 364727-87-7
CAS 364727-87-7 appears in our catalog under these names: Methyl 6-bromo-2,3-difluorobenzoate, 95%, Methyl 6-Bromo-2,3-Difluorobenzoate, 97%. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
Methyl 6-bromo-2,3-difluorobenzoate (CAS 364727-87-7) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: methyl 6-bromo-2,3-difluorobenzoate. InChIKey: KKCARDZOSATPBH-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | methyl 6-bromo-2,3-difluorobenzoate |
| InChIKey | KKCARDZOSATPBH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1F)F)Br |
Computed by PubChem (NCBI)