CAS 36802-47-8 appears in our catalog under these names: Ethyl 2,4-Dichloro-6-methylpyrimidine-5-carboxylate, ≥95%, ≥95%, Ethyl 2,4-dichloro-6-methylpyrimidine-5-carboxylate, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
Ethyl 2,4-dichloro-6-methylpyrimidine-5-carboxylate (CAS 36802-47-8) is a chemical compound with the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.06 g/mol. IUPAC name: ethyl 2,4-dichloro-6-methylpyrimidine-5-carboxylate. InChIKey: NBLFZEOAMBXUEI-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O2 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | ethyl 2,4-dichloro-6-methylpyrimidine-5-carboxylate |
| InChIKey | NBLFZEOAMBXUEI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(N=C1Cl)Cl)C |
Computed by PubChem (NCBI)