CAS 3682-19-7 appears in our catalog under these names: 6-Nitro-2,3-dihydrophthalazine-1,4-dione, 95+%, 4–Nitrophthalic Hydrazide, 4-Nitrophthalic Hydrazide, >98.0%(HPLC)(T), 6-Nitro-2,3-dihydrophthalazine-1,4-dione, 98.0%, 98.0%, 6-Nitro-2,3-dihydrophthalazine-1,4-dione, 98%,RG. Offered by: AmBeed, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 500g.
6-nitro-2,3-dihydrophthalazine-1,4-dione (CAS 3682-19-7) is a chemical compound with the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. IUPAC name: 6-nitro-2,3-dihydrophthalazine-1,4-dione. InChIKey: XQFIOLKLHNOFCA-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O4 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 6-nitro-2,3-dihydrophthalazine-1,4-dione |
| InChIKey | XQFIOLKLHNOFCA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=O)NNC2=O |
Computed by PubChem (NCBI)