Products 431942-67-5
CAS 431942-67-5 appears in our catalog under these names: 2,4-Dichloro-5-methoxyphenylboronic acid, 98%, (2,4-Dichloro-5-methoxyphenyl)boronic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed, BLDpharm. Available pack sizes: 5g, 100mg, 250mg, 1g.
(2,4-dichloro-5-methoxyphenyl)boronic acid (CAS 431942-67-5) is a chemical compound with the molecular formula C7H7BCl2O3 and a molecular weight of 220.84 g/mol. IUPAC name: (2,4-dichloro-5-methoxyphenyl)boronic acid. InChIKey: RNRFSHDFAVUELD-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O3 |
|---|---|
| Molecular weight | 220.84 g/mol |
| IUPAC name | (2,4-dichloro-5-methoxyphenyl)boronic acid |
| InChIKey | RNRFSHDFAVUELD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)Cl)OC)(O)O |
Computed by PubChem (NCBI)