CAS 458543-81-2 appears in our catalog under these names: Ethyl 3–amino–2,6–dichloroisonicotinate, Ethyl 3-amino-2,6-dichloroisonicotinate, 98%, 98%, Ethyl 3-amino-2,6-dichloroisonicotinate, 98%, Ethyl 3-amino-2,6-dichloroisonicotinate, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 25g, 5g.
Ethyl 3-amino-2,6-dichloropyridine-4-carboxylate (CAS 458543-81-2) is a chemical compound with the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.06 g/mol. IUPAC name: ethyl 3-amino-2,6-dichloropyridine-4-carboxylate. InChIKey: ZBHSEGWPJCOBKP-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O2 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | ethyl 3-amino-2,6-dichloropyridine-4-carboxylate |
| InChIKey | ZBHSEGWPJCOBKP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NC(=C1N)Cl)Cl |
Computed by PubChem (NCBI)