CAS 4743-17-3 appears in our catalog under these names: 5–Chloroisatoic anhydride, 5-Chloroisatoic anhydride, 5-Chloroisatoic Anhydride, >98.0%(HPLC)(T), 6-Chloro-1H-benzo[d][1,3]oxazine-2,4-dione 97%, 5-Chloroisatoic Anhydride, 97%, 97%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 500g, 250g, 5g, 1000g, 10g, 1g.
6-chloro-1H-3,1-benzoxazine-2,4-dione (CAS 4743-17-3) is a chemical compound with the molecular formula C8H4ClNO3 and a molecular weight of 197.57 g/mol. IUPAC name: 6-chloro-1H-3,1-benzoxazine-2,4-dione. InChIKey: MYQFJMYJVJRSGP-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO3 |
|---|---|
| Molecular weight | 197.57 g/mol |
| IUPAC name | 6-chloro-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | MYQFJMYJVJRSGP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)