CAS 502546-42-1 appears in our catalog under these names: 5-(2,4-Dimethoxyphenyl)-4H-1,2,4-triazol-3-amine, 95%, 5-(2,4-Dimethoxyphenyl)-4H-1,2,4-triazol-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
5-(2,4-dimethoxyphenyl)-1H-1,2,4-triazol-3-amine (CAS 502546-42-1) is a chemical compound with the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. IUPAC name: 5-(2,4-dimethoxyphenyl)-1H-1,2,4-triazol-3-amine. InChIKey: UDKYVTNKLFCNDE-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2 |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | 5-(2,4-dimethoxyphenyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | UDKYVTNKLFCNDE-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2=NC(=NN2)N)OC |
Computed by PubChem (NCBI)