CAS 53531-69-4 appears in our catalog under these names: (4–Bromophenyl)methanesulfonyl chloride, (4-Bromophenyl)methanesulfonyl chloride, 4-Bromobenzylsulfonyl chloride, 95%, 4-Bromobenzylsulfonyl chloride, 97%, (4-Bromophenyl)methanesulfonyl chloride, 95% . Offered by: GLPBio, Biosynth, Thermo Scientific (Acros), Fluorochem, Thermo Scientific. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 50g, 100g.
(4-bromophenyl)methanesulfonyl chloride (CAS 53531-69-4) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: (4-bromophenyl)methanesulfonyl chloride. InChIKey: ZWVWFWGJZPHCHF-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | (4-bromophenyl)methanesulfonyl chloride |
| InChIKey | ZWVWFWGJZPHCHF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CS(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)