CAS 537033-54-8 appears in our catalog under these names: 4–Bromo–2,6–difluorophenylacetic Acid, 4-Bromo-2,6-difluorophenylacetic acid, 96% , 4-Bromo-2,6-difluorophenylacetic Acid, 97%, 97%, 4-Bromo-2,6-difluorophenylacetic acid, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 25g, 100g, 10g.
2-(4-bromo-2,6-difluorophenyl)acetic acid (CAS 537033-54-8) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: 2-(4-bromo-2,6-difluorophenyl)acetic acid. InChIKey: GBFFYYLXGIHKLU-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 2-(4-bromo-2,6-difluorophenyl)acetic acid |
| InChIKey | GBFFYYLXGIHKLU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)CC(=O)O)F)Br |
Computed by PubChem (NCBI)