CAS 54091-06-4 appears in our catalog under these names: 1-Bromo-4-((chloromethyl)sulfonyl)benzene, 95%, 1-Bromo-4-((chloromethyl)sulfonyl)benzene, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
1-bromo-4-(chloromethylsulfonyl)benzene (CAS 54091-06-4) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: 1-bromo-4-(chloromethylsulfonyl)benzene. InChIKey: AHXUVTKVCMOKIX-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | 1-bromo-4-(chloromethylsulfonyl)benzene |
| InChIKey | AHXUVTKVCMOKIX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)CCl)Br |
Computed by PubChem (NCBI)